C20H26N2O4 — CID 4650313
N-(2,4-dimethoxyphenyl)-6,8-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 4650313) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6,8-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | N-(2,4-dimethoxyphenyl)-6,8-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 4650313 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6,8-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | COc1ccc(NC2CC(C)Nc3c(OC)cc(OC)cc32)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O4/c1-12-8-17(22-16-7-6-13(23-2)10-18(16)25-4)15-9-14(24-3)11-19(26-5)20(15)21-12/h6-7,9-12,17,21-22H,8H2,1-5H3 |
| InChIKey | KGUVDVVKWWTBGW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|