C13H19NO3 — CID 82276016
4,6,8-trimethoxy-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 82276016) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4,6,8-trimethoxy-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4,6,8-trimethoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 82276016 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4,6,8-trimethoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cc(OC)c2c(c1)C(OC)CC(C)N2 |
| InChI | InChI=1S/C13H19NO3/c1-8-5-11(16-3)10-6-9(15-2)7-12(17-4)13(10)14-8/h6-8,11,14H,5H2,1-4H3 |
| InChIKey | UTVDDMDZQOSTBL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|