C10H13NO2 — CID 13396026
3,5-dimethoxy-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 13396026) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 3,5-dimethoxy-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | 3,5-dimethoxy-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 13396026 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3,5-dimethoxy-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | COc1cnc2c(c1)C(OC)CC2 |
| InChI | InChI=1S/C10H13NO2/c1-12-7-5-8-9(11-6-7)3-4-10(8)13-2/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | JDPSKKZXRIJDEP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |