About 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene
4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 70136991) has the molecular formula C8H10OS
and a molecular weight of 154.23 g/mol. Its IUPAC name is 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene.
Analyze 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene?
The IUPAC name of 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene (CID 70136991) is 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene.
What is the SMILES notation for 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene?
The canonical SMILES for 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene is COC1CCc2sccc21.
What is the InChIKey of 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene?
The InChIKey is PPIJRPSAHIANQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS/c1-9-7-2-3-8-6(7)4-5-10-8/h4-5,7H,2-3H2,1H3.
What are the key properties of 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene?
4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene has a molecular weight of 154.23 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophene is sourced from PubChem (CID 70136991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).