About ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen
ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen (PubChem CID 143347244) has the molecular formula C15H33NS
and a molecular weight of 259.50 g/mol. Its IUPAC name is ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen |
| PubChem CID | 143347244 |
| Molecular Formula | C15H33NS |
| Molecular Weight | 259.50 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen |
| SMILES | CC.CC.CC.CCNC1CCc2sccc21.[H][H] |
| InChI | InChI=1S/C9H13NS.3C2H6.H2/c1-2-10-8-3-4-9-7(8)5-6-11-9;3*1-2;/h5-6,8,10H,2-4H2,1H3;3*1-2H3;1H |
| InChIKey | CTELMGVUOLZFKA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen?
The IUPAC name of ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen (CID 143347244) is ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen.
What is the SMILES notation for ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen?
The canonical SMILES for ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen is CC.CC.CC.CCNC1CCc2sccc21.[H][H].
What is the InChIKey of ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen?
The InChIKey is CTELMGVUOLZFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS.3C2H6.H2/c1-2-10-8-3-4-9-7(8)5-6-11-9;3*1-2;/h5-6,8,10H,2-4H2,1H3;3*1-2H3;1H.
What are the key properties of ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen?
ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen has a molecular weight of 259.50 g/mol, XLogP of 5.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine;molecular hydrogen is sourced from PubChem (CID 143347244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).