C25H23N5O6S — CID 4650374
2-[cyclopropyl-[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(2,4-dimethoxyphenyl)-2-(thiadiazol-4-yl)acetamide (PubChem CID 4650374) has the molecular formula C25H23N5O6S and a molecular weight of 521.56 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(2,4-dimethoxyphenyl)-2-(thiadiazol-4-yl)acetamide.
| Compound Name | 2-[cyclopropyl-[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(2,4-dimethoxyphenyl)-2-(thiadiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 4650374 |
| Molecular Formula | C25H23N5O6S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2-[cyclopropyl-[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(2,4-dimethoxyphenyl)-2-(thiadiazol-4-yl)acetamide |
| SMILES | COc1ccc(NC(=O)C(c2csnn2)N(C(=O)CN2C(=O)c3ccccc3C2=O)C2CC2)c(OC)c1 |
| InChI | InChI=1S/C25H23N5O6S/c1-35-15-9-10-18(20(11-15)36-2)26-23(32)22(19-13-37-28-27-19)30(14-7-8-14)21(31)12-29-24(33)16-5-3-4-6-17(16)25(29)34/h3-6,9-11,13-14,22H,7-8,12H2,1-2H3,(H,26,32) |
| InChIKey | JXGDXBZTQUVRFA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|