C30H30N6O4S — CID 3288439
N-(1-adamantyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-(thiadiazol-4-yl)acetamide (PubChem CID 3288439) has the molecular formula C30H30N6O4S and a molecular weight of 570.68 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-(thiadiazol-4-yl)acetamide.
| Compound Name | N-(1-adamantyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-(thiadiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 3288439 |
| Molecular Formula | C30H30N6O4S |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | N-(1-adamantyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-(thiadiazol-4-yl)acetamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C(c1csnn1)N(Cc1cccnc1)C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H30N6O4S/c37-25(16-36-28(39)22-5-1-2-6-23(22)29(36)40)35(15-18-4-3-7-31-14-18)26(24-17-41-34-33-24)27(38)32-30-11-19-8-20(12-30)10-21(9-19)13-30/h1-7,14,17,19-21,26H,8-13,15-16H2,(H,32,38) |
| InChIKey | IOVGRSSECRUCMD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|