C15H21ClN4O2S — CID 46511184
2-[(4-chlorophenyl)-(diethylsulfamoylamino)methyl]-1-methylimidazole (PubChem CID 46511184) has the molecular formula C15H21ClN4O2S and a molecular weight of 356.88 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-(diethylsulfamoylamino)methyl]-1-methylimidazole.
| Compound Name | 2-[(4-chlorophenyl)-(diethylsulfamoylamino)methyl]-1-methylimidazole |
|---|---|
| PubChem CID | 46511184 |
| Molecular Formula | C15H21ClN4O2S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-[(4-chlorophenyl)-(diethylsulfamoylamino)methyl]-1-methylimidazole |
| SMILES | CCN(CC)S(=O)(=O)NC(c1ccc(Cl)cc1)c1nccn1C |
| InChI | InChI=1S/C15H21ClN4O2S/c1-4-20(5-2)23(21,22)18-14(15-17-10-11-19(15)3)12-6-8-13(16)9-7-12/h6-11,14,18H,4-5H2,1-3H3 |
| InChIKey | VKWGKWWLAFFXCJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |