C15H14ClN3O2S2 — CID 17416898
N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]thiophene-2-sulfonamide (PubChem CID 17416898) has the molecular formula C15H14ClN3O2S2 and a molecular weight of 367.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 17416898 |
| Molecular Formula | C15H14ClN3O2S2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cn1ccnc1C(NS(=O)(=O)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClN3O2S2/c1-19-9-8-17-15(19)14(11-4-6-12(16)7-5-11)18-23(20,21)13-3-2-10-22-13/h2-10,14,18H,1H3 |
| InChIKey | SPNVWJJQBGBQJP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |