C16H19BrN2O3S — CID 46511196
1-[(3-bromophenyl)methyl]-N,N-diethyl-6-oxopyridine-3-sulfonamide (PubChem CID 46511196) has the molecular formula C16H19BrN2O3S and a molecular weight of 399.31 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N,N-diethyl-6-oxopyridine-3-sulfonamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N,N-diethyl-6-oxopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 46511196 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N,N-diethyl-6-oxopyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(Cc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C16H19BrN2O3S/c1-3-19(4-2)23(21,22)15-8-9-16(20)18(12-15)11-13-6-5-7-14(17)10-13/h5-10,12H,3-4,11H2,1-2H3 |
| InChIKey | BREIQILJOAZZTO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |