C27H23N3O3S — CID 25466968
N,N-dibenzyl-1-[(3-cyanophenyl)methyl]-6-oxopyridine-3-sulfonamide (PubChem CID 25466968) has the molecular formula C27H23N3O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is N,N-dibenzyl-1-[(3-cyanophenyl)methyl]-6-oxopyridine-3-sulfonamide.
| Compound Name | N,N-dibenzyl-1-[(3-cyanophenyl)methyl]-6-oxopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 25466968 |
| Molecular Formula | C27H23N3O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N,N-dibenzyl-1-[(3-cyanophenyl)methyl]-6-oxopyridine-3-sulfonamide |
| SMILES | N#Cc1cccc(Cn2cc(S(=O)(=O)N(Cc3ccccc3)Cc3ccccc3)ccc2=O)c1 |
| InChI | InChI=1S/C27H23N3O3S/c28-17-24-12-7-13-25(16-24)18-29-21-26(14-15-27(29)31)34(32,33)30(19-22-8-3-1-4-9-22)20-23-10-5-2-6-11-23/h1-16,21H,18-20H2 |
| InChIKey | SQMZXQPHLNFWDG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 83.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |