C25H17N3O — CID 22268242
3-[[3-oxo-7-(3-phenylprop-1-ynyl)-2,6-naphthyridin-2-yl]methyl]benzonitrile (PubChem CID 22268242) has the molecular formula C25H17N3O and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-[[3-oxo-7-(3-phenylprop-1-ynyl)-2,6-naphthyridin-2-yl]methyl]benzonitrile.
| Compound Name | 3-[[3-oxo-7-(3-phenylprop-1-ynyl)-2,6-naphthyridin-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 22268242 |
| Molecular Formula | C25H17N3O |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-[[3-oxo-7-(3-phenylprop-1-ynyl)-2,6-naphthyridin-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cn2cc3cc(C#CCc4ccccc4)ncc3cc2=O)c1 |
| InChI | InChI=1S/C25H17N3O/c26-15-20-9-4-10-21(12-20)17-28-18-23-13-24(27-16-22(23)14-25(28)29)11-5-8-19-6-2-1-3-7-19/h1-4,6-7,9-10,12-14,16,18H,8,17H2 |
| InChIKey | VWWBSYYYSDYSQK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|