About 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one
6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one (PubChem CID 22268228) has the molecular formula C23H15F2N3O
and a molecular weight of 387.39 g/mol. Its IUPAC name is 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one.
Molecular Properties
| Compound Name | 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one |
| PubChem CID | 22268228 |
| Molecular Formula | C23H15F2N3O |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one |
| SMILES | O=c1cc2ncc(C#CCc3ccccc3)nc2cn1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H15F2N3O/c24-19-10-9-17(11-20(19)25)14-28-15-22-21(12-23(28)29)26-13-18(27-22)8-4-7-16-5-2-1-3-6-16/h1-3,5-6,9-13,15H,7,14H2 |
| InChIKey | BVOIUXVROAEIMY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one?
The IUPAC name of 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one (CID 22268228) is 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one.
What is the SMILES notation for 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one?
The canonical SMILES for 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one is O=c1cc2ncc(C#CCc3ccccc3)nc2cn1Cc1ccc(F)c(F)c1.
What is the InChIKey of 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one?
The InChIKey is BVOIUXVROAEIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2N3O/c24-19-10-9-17(11-20(19)25)14-28-15-22-21(12-23(28)29)26-13-18(27-22)8-4-7-16-5-2-1-3-6-16/h1-3,5-6,9-13,15H,7,14H2.
What are the key properties of 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one?
6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one has a molecular weight of 387.39 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,4-difluorophenyl)methyl]-3-(3-phenylprop-1-ynyl)pyrido[3,4-b]pyrazin-7-one is sourced from PubChem (CID 22268228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).