C16H11N3O6 — CID 4651135
4-[3-methylidene-4-[(5-nitrofuran-2-yl)methylidene]-5-oxopyrazolidin-1-yl]benzoic acid (PubChem CID 4651135) has the molecular formula C16H11N3O6 and a molecular weight of 341.28 g/mol. Its IUPAC name is 4-[3-methylidene-4-[(5-nitrofuran-2-yl)methylidene]-5-oxopyrazolidin-1-yl]benzoic acid.
| Compound Name | 4-[3-methylidene-4-[(5-nitrofuran-2-yl)methylidene]-5-oxopyrazolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4651135 |
| Molecular Formula | C16H11N3O6 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-[3-methylidene-4-[(5-nitrofuran-2-yl)methylidene]-5-oxopyrazolidin-1-yl]benzoic acid |
| SMILES | C=c1[nH]n(-c2ccc(C(=O)O)cc2)c(=O)c1=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C16H11N3O6/c1-9-13(8-12-6-7-14(25-12)19(23)24)15(20)18(17-9)11-4-2-10(3-5-11)16(21)22/h2-8,17H,1H2,(H,21,22) |
| InChIKey | VYFZFWRJPQEYTM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|