C14H17F3N4O3S — CID 46518634
ethyl 4-[2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetyl]piperazine-1-carboxylate (PubChem CID 46518634) has the molecular formula C14H17F3N4O3S and a molecular weight of 378.38 g/mol. Its IUPAC name is ethyl 4-[2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46518634 |
| Molecular Formula | C14H17F3N4O3S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | ethyl 4-[2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CSc2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C14H17F3N4O3S/c1-2-24-13(23)21-7-5-20(6-8-21)11(22)9-25-12-18-4-3-10(19-12)14(15,16)17/h3-4H,2,5-9H2,1H3 |
| InChIKey | OADVTCHHWMIBSN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |