C13H16F3N3OS — CID 46518643
1-(3-methylpiperidin-1-yl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylethanone (PubChem CID 46518643) has the molecular formula C13H16F3N3OS and a molecular weight of 319.35 g/mol. Its IUPAC name is 1-(3-methylpiperidin-1-yl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylethanone.
| Compound Name | 1-(3-methylpiperidin-1-yl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylethanone |
|---|---|
| PubChem CID | 46518643 |
| Molecular Formula | C13H16F3N3OS |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-(3-methylpiperidin-1-yl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylethanone |
| SMILES | CC1CCCN(C(=O)CSc2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C13H16F3N3OS/c1-9-3-2-6-19(7-9)11(20)8-21-12-17-5-4-10(18-12)13(14,15)16/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | OXVKZNKEWROSOP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |