C18H25N3O3S2 — CID 46522932
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(2-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 46522932) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(2-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(2-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 46522932 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(2-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1ccccc1N(CC(=O)NCC(c1cccs1)N(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C18H25N3O3S2/c1-14-8-5-6-9-15(14)21(26(4,23)24)13-18(22)19-12-16(20(2)3)17-10-7-11-25-17/h5-11,16H,12-13H2,1-4H3,(H,19,22) |
| InChIKey | ZRZMBVDPERLJBY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |