C17H18N2O6S2 — CID 8508465
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(2-methyl-N-methylsulfonylanilino)acetate (PubChem CID 8508465) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(2-methyl-N-methylsulfonylanilino)acetate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(2-methyl-N-methylsulfonylanilino)acetate |
|---|---|
| PubChem CID | 8508465 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(2-methyl-N-methylsulfonylanilino)acetate |
| SMILES | Cc1ccccc1N(CC(=O)OCC(=O)NC(=O)c1cccs1)S(C)(=O)=O |
| InChI | InChI=1S/C17H18N2O6S2/c1-12-6-3-4-7-13(12)19(27(2,23)24)10-16(21)25-11-15(20)18-17(22)14-8-5-9-26-14/h3-9H,10-11H2,1-2H3,(H,18,20,22) |
| InChIKey | PHIQJWLQZRNRTQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |