C24H18ClN3O2S — CID 46531626
N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-(2-cyanophenyl)sulfanylbenzamide (PubChem CID 46531626) has the molecular formula C24H18ClN3O2S and a molecular weight of 447.95 g/mol. Its IUPAC name is N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-(2-cyanophenyl)sulfanylbenzamide.
| Compound Name | N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-(2-cyanophenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 46531626 |
| Molecular Formula | C24H18ClN3O2S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-(2-cyanophenyl)sulfanylbenzamide |
| SMILES | N#Cc1ccccc1Sc1ccccc1C(=O)Nc1ccc(N2CCCC2=O)c(Cl)c1 |
| InChI | InChI=1S/C24H18ClN3O2S/c25-19-14-17(11-12-20(19)28-13-5-10-23(28)29)27-24(30)18-7-2-4-9-22(18)31-21-8-3-1-6-16(21)15-26/h1-4,6-9,11-12,14H,5,10,13H2,(H,27,30) |
| InChIKey | AEGWIDNFWADBCL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |