C21H16N4O2S — CID 34111218
N-[3-(carbamoylamino)phenyl]-2-(2-cyanophenyl)sulfanylbenzamide (PubChem CID 34111218) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-2-(2-cyanophenyl)sulfanylbenzamide.
| Compound Name | N-[3-(carbamoylamino)phenyl]-2-(2-cyanophenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 34111218 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-2-(2-cyanophenyl)sulfanylbenzamide |
| SMILES | N#Cc1ccccc1Sc1ccccc1C(=O)Nc1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C21H16N4O2S/c22-13-14-6-1-3-10-18(14)28-19-11-4-2-9-17(19)20(26)24-15-7-5-8-16(12-15)25-21(23)27/h1-12H,(H,24,26)(H3,23,25,27) |
| InChIKey | DKLVHTPADNYSOS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |