C24H18N4OS — CID 60557057
2-(2-cyanophenyl)sulfanyl-N-[3-(1-methylimidazol-2-yl)phenyl]benzamide (PubChem CID 60557057) has the molecular formula C24H18N4OS and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfanyl-N-[3-(1-methylimidazol-2-yl)phenyl]benzamide.
| Compound Name | 2-(2-cyanophenyl)sulfanyl-N-[3-(1-methylimidazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 60557057 |
| Molecular Formula | C24H18N4OS |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-(2-cyanophenyl)sulfanyl-N-[3-(1-methylimidazol-2-yl)phenyl]benzamide |
| SMILES | Cn1ccnc1-c1cccc(NC(=O)c2ccccc2Sc2ccccc2C#N)c1 |
| InChI | InChI=1S/C24H18N4OS/c1-28-14-13-26-23(28)17-8-6-9-19(15-17)27-24(29)20-10-3-5-12-22(20)30-21-11-4-2-7-18(21)16-25/h2-15H,1H3,(H,27,29) |
| InChIKey | JABAGLZGEZXQNX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |