C23H16N4O2S2 — CID 55769470
N-(2-acetamido-1,3-benzothiazol-6-yl)-2-(2-cyanophenyl)sulfanylbenzamide (PubChem CID 55769470) has the molecular formula C23H16N4O2S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-(2-acetamido-1,3-benzothiazol-6-yl)-2-(2-cyanophenyl)sulfanylbenzamide.
| Compound Name | N-(2-acetamido-1,3-benzothiazol-6-yl)-2-(2-cyanophenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 55769470 |
| Molecular Formula | C23H16N4O2S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | N-(2-acetamido-1,3-benzothiazol-6-yl)-2-(2-cyanophenyl)sulfanylbenzamide |
| SMILES | CC(=O)Nc1nc2ccc(NC(=O)c3ccccc3Sc3ccccc3C#N)cc2s1 |
| InChI | InChI=1S/C23H16N4O2S2/c1-14(28)25-23-27-18-11-10-16(12-21(18)31-23)26-22(29)17-7-3-5-9-20(17)30-19-8-4-2-6-15(19)13-24/h2-12H,1H3,(H,26,29)(H,25,27,28) |
| InChIKey | WDMCYAUQZIWKAY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |