C20H23F3N2O3S — CID 46533772
N-benzyl-N-propyl-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 46533772) has the molecular formula C20H23F3N2O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is N-benzyl-N-propyl-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | N-benzyl-N-propyl-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 46533772 |
| Molecular Formula | C20H23F3N2O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-benzyl-N-propyl-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | CCCN(Cc1ccccc1)C(=O)C(C)NS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O3S/c1-3-13-25(14-16-9-5-4-6-10-16)19(26)15(2)24-29(27,28)18-12-8-7-11-17(18)20(21,22)23/h4-12,15,24H,3,13-14H2,1-2H3 |
| InChIKey | KELJRQCSFKISBL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |