C28H33N3O — CID 46536145
2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)acetamide (PubChem CID 46536145) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)acetamide.
| Compound Name | 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)acetamide |
|---|---|
| PubChem CID | 46536145 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)acetamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)NCC1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C28H33N3O/c1-17(2)16-31-19(4)25(18(3)30-31)14-27(32)29-15-20-13-26-21-9-5-7-11-23(21)28(20)24-12-8-6-10-22(24)26/h5-12,17,20,26,28H,13-16H2,1-4H3,(H,29,32) |
| InChIKey | BOYCMIWBMOATTM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |