C16H20N2O5S — CID 46544703
2-methoxyethyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate (PubChem CID 46544703) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-methoxyethyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate.
| Compound Name | 2-methoxyethyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46544703 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-methoxyethyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate |
| SMILES | COCCOC(=O)C1CCCN(C2=NS(=O)(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C16H20N2O5S/c1-22-9-10-23-16(19)12-5-4-8-18(11-12)15-13-6-2-3-7-14(13)24(20,21)17-15/h2-3,6-7,12H,4-5,8-11H2,1H3 |
| InChIKey | KSFFSMOAQOGVFE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|