C21H20N2O5S — CID 8646502
(4-acetylphenyl) (3S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate (PubChem CID 8646502) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is (4-acetylphenyl) (3S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate.
| Compound Name | (4-acetylphenyl) (3S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 8646502 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (4-acetylphenyl) (3S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate |
| SMILES | CC(=O)c1ccc(OC(=O)[C@H]2CCCN(C3=NS(=O)(=O)c4ccccc43)C2)cc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-14(24)15-8-10-17(11-9-15)28-21(25)16-5-4-12-23(13-16)20-18-6-2-3-7-19(18)29(26,27)22-20/h2-3,6-11,16H,4-5,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | GJDAPOVWAMZZLX-INIZCTEOSA-N |
| XLogP | 2.66 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|