C21H20N2O5S — CID 47009886
(2-acetylphenyl) 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate (PubChem CID 47009886) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is (2-acetylphenyl) 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate.
| Compound Name | (2-acetylphenyl) 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 47009886 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (2-acetylphenyl) 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-3-carboxylate |
| SMILES | CC(=O)c1ccccc1OC(=O)C1CCCN(C2=NS(=O)(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C21H20N2O5S/c1-14(24)16-8-2-4-10-18(16)28-21(25)15-7-6-12-23(13-15)20-17-9-3-5-11-19(17)29(26,27)22-20/h2-5,8-11,15H,6-7,12-13H2,1H3 |
| InChIKey | GRENCIKPJMZAQN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|