C17H15Cl2N5O — CID 46547369
N-[1-(2,4-dichlorophenyl)ethyl]-3-methyl-4-(tetrazol-1-yl)benzamide (PubChem CID 46547369) has the molecular formula C17H15Cl2N5O and a molecular weight of 376.25 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-3-methyl-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-3-methyl-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46547369 |
| Molecular Formula | C17H15Cl2N5O |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-3-methyl-4-(tetrazol-1-yl)benzamide |
| SMILES | Cc1cc(C(=O)NC(C)c2ccc(Cl)cc2Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C17H15Cl2N5O/c1-10-7-12(3-6-16(10)24-9-20-22-23-24)17(25)21-11(2)14-5-4-13(18)8-15(14)19/h3-9,11H,1-2H3,(H,21,25) |
| InChIKey | MXKPMHGYCLOHEO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |