C25H26N2O4S — CID 46557429
N-[4-(4-ethoxyphenoxy)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide (PubChem CID 46557429) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenoxy)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[4-(4-ethoxyphenoxy)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46557429 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[4-(4-ethoxyphenoxy)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
| SMILES | CCOc1ccc(Oc2ccc(NC(=O)C3CCCN(C(=O)c4cccs4)C3)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O4S/c1-2-30-20-11-13-22(14-12-20)31-21-9-7-19(8-10-21)26-24(28)18-5-3-15-27(17-18)25(29)23-6-4-16-32-23/h4,6-14,16,18H,2-3,5,15,17H2,1H3,(H,26,28) |
| InChIKey | YGFNNCXEJCQDEU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |