C24H24N2O4S — CID 55559806
N-[4-(2-methoxyphenoxy)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide (PubChem CID 55559806) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[4-(2-methoxyphenoxy)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[4-(2-methoxyphenoxy)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55559806 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[4-(2-methoxyphenoxy)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)C2CCCN(C(=O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-29-20-7-2-3-8-21(20)30-19-12-10-18(11-13-19)25-23(27)17-6-4-14-26(16-17)24(28)22-9-5-15-31-22/h2-3,5,7-13,15,17H,4,6,14,16H2,1H3,(H,25,27) |
| InChIKey | QOWAXZKSGFJMKF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |