C19H28N4O4 — CID 46561956
N-(cyclopentylcarbamoyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]propanamide (PubChem CID 46561956) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]propanamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 46561956 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]propanamide |
| SMILES | COc1ccc(NC(=O)CN(C)C(C)C(=O)NC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C19H28N4O4/c1-13(18(25)22-19(26)21-14-6-4-5-7-14)23(2)12-17(24)20-15-8-10-16(27-3)11-9-15/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,24)(H2,21,22,25,26) |
| InChIKey | OJOMBVSLLMSITH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |