C16H22N4O4 — CID 9222752
2-[[2-(cyclopropylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(4-methoxyphenyl)acetamide (PubChem CID 9222752) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[[2-(cyclopropylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(cyclopropylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9222752 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[[2-(cyclopropylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)CC(=O)NC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C16H22N4O4/c1-20(10-15(22)19-16(23)18-12-3-4-12)9-14(21)17-11-5-7-13(24-2)8-6-11/h5-8,12H,3-4,9-10H2,1-2H3,(H,17,21)(H2,18,19,22,23) |
| InChIKey | OXYBXYKXQFGYMT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |