C20H30N4O4 — CID 9222589
(2R)-N-(cyclohexylcarbamoyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]propanamide (PubChem CID 9222589) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2R)-N-(cyclohexylcarbamoyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]propanamide.
| Compound Name | (2R)-N-(cyclohexylcarbamoyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 9222589 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (2R)-N-(cyclohexylcarbamoyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]propanamide |
| SMILES | COc1ccc(NC(=O)CN(C)[C@H](C)C(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H30N4O4/c1-14(19(26)23-20(27)22-15-7-5-4-6-8-15)24(2)13-18(25)21-16-9-11-17(28-3)12-10-16/h9-12,14-15H,4-8,13H2,1-3H3,(H,21,25)(H2,22,23,26,27)/t14-/m1/s1 |
| InChIKey | UMROMWVBTACYOB-CQSZACIVSA-N |
| XLogP | 2.11 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |