C17H17F2NOS — CID 46575169
N-(3,4-difluorophenyl)-3-[(3-methylphenyl)methylsulfanyl]propanamide (PubChem CID 46575169) has the molecular formula C17H17F2NOS and a molecular weight of 321.39 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-[(3-methylphenyl)methylsulfanyl]propanamide.
| Compound Name | N-(3,4-difluorophenyl)-3-[(3-methylphenyl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 46575169 |
| Molecular Formula | C17H17F2NOS |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-[(3-methylphenyl)methylsulfanyl]propanamide |
| SMILES | Cc1cccc(CSCCC(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H17F2NOS/c1-12-3-2-4-13(9-12)11-22-8-7-17(21)20-14-5-6-15(18)16(19)10-14/h2-6,9-10H,7-8,11H2,1H3,(H,20,21) |
| InChIKey | PHGLEUAZWBHAEK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|