C20H21FN2O2S — CID 86939681
N-[3-fluoro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide (PubChem CID 86939681) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[3-fluoro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[3-fluoro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 86939681 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[3-fluoro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cccc(CSCC(=O)Nc2ccc(N3CCCC3=O)c(F)c2)c1 |
| InChI | InChI=1S/C20H21FN2O2S/c1-14-4-2-5-15(10-14)12-26-13-19(24)22-16-7-8-18(17(21)11-16)23-9-3-6-20(23)25/h2,4-5,7-8,10-11H,3,6,9,12-13H2,1H3,(H,22,24) |
| InChIKey | CHOFSPGDCKWOCA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |