C19H20ClN3O4 — CID 46579661
2-chloro-N-[1-[3-[(2-methoxyacetyl)amino]anilino]-1-oxopropan-2-yl]benzamide (PubChem CID 46579661) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-chloro-N-[1-[3-[(2-methoxyacetyl)amino]anilino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[3-[(2-methoxyacetyl)amino]anilino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 46579661 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-chloro-N-[1-[3-[(2-methoxyacetyl)amino]anilino]-1-oxopropan-2-yl]benzamide |
| SMILES | COCC(=O)Nc1cccc(NC(=O)C(C)NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-12(21-19(26)15-8-3-4-9-16(15)20)18(25)23-14-7-5-6-13(10-14)22-17(24)11-27-2/h3-10,12H,11H2,1-2H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | HRDKFNAEFNCWCA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |