C19H20N2O5S — CID 46590064
N-[(2,4-dimethoxyphenyl)methyl]-3-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 46590064) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46590064 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)NCc2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C19H20N2O5S/c1-4-10-21-27(23,24)17-7-5-6-14(11-17)19(22)20-13-15-8-9-16(25-2)12-18(15)26-3/h1,5-9,11-12,21H,10,13H2,2-3H3,(H,20,22) |
| InChIKey | WJPXFYUPLGCRIW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|