C16H21N3O3S — CID 46592129
N-[3-[[2-(dimethylamino)-2-thiophen-3-ylethyl]amino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 46592129) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[3-[[2-(dimethylamino)-2-thiophen-3-ylethyl]amino]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-(dimethylamino)-2-thiophen-3-ylethyl]amino]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46592129 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[3-[[2-(dimethylamino)-2-thiophen-3-ylethyl]amino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | CN(C)C(CNC(=O)CCNC(=O)c1ccco1)c1ccsc1 |
| InChI | InChI=1S/C16H21N3O3S/c1-19(2)13(12-6-9-23-11-12)10-18-15(20)5-7-17-16(21)14-4-3-8-22-14/h3-4,6,8-9,11,13H,5,7,10H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | FXYQMPUIMKRCEL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |