C17H17ClN2O2S — CID 46592179
5-chloro-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-1-benzofuran-2-carboxamide (PubChem CID 46592179) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is 5-chloro-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 46592179 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 5-chloro-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-1-benzofuran-2-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1cc2cc(Cl)ccc2o1)c1ccsc1 |
| InChI | InChI=1S/C17H17ClN2O2S/c1-20(2)14(11-5-6-23-10-11)9-19-17(21)16-8-12-7-13(18)3-4-15(12)22-16/h3-8,10,14H,9H2,1-2H3,(H,19,21) |
| InChIKey | IBQKECYKIUZLSN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |