C14H16N4O4S2 — CID 46596642
3-[4-methyl-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]thiolane 1,1-dioxide (PubChem CID 46596642) has the molecular formula C14H16N4O4S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-[4-methyl-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[4-methyl-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 46596642 |
| Molecular Formula | C14H16N4O4S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 3-[4-methyl-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
| SMILES | Cn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N4O4S2/c1-17-13(11-6-7-24(21,22)9-11)15-16-14(17)23-8-10-2-4-12(5-3-10)18(19)20/h2-5,11H,6-9H2,1H3 |
| InChIKey | HSPJHOCRQDVCMD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 107.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|