C20H19F2N3O6 — CID 46606339
[2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate (PubChem CID 46606339) has the molecular formula C20H19F2N3O6 and a molecular weight of 435.38 g/mol. Its IUPAC name is [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate.
| Compound Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 46606339 |
| Molecular Formula | C20H19F2N3O6 |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)C2CC=CCC2C1=O)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H19F2N3O6/c21-14-6-5-11(7-15(14)22)24-16(26)8-23-17(27)10-31-18(28)9-25-19(29)12-3-1-2-4-13(12)20(25)30/h1-2,5-7,12-13H,3-4,8-10H2,(H,23,27)(H,24,26) |
| InChIKey | HCNYCXGHOQVEDU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|