C23H26N4O4S — CID 46608984
[2-(2-methoxyethylamino)-2-oxoethyl] 5-phenyl-2-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridine-7-carboxylate (PubChem CID 46608984) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 5-phenyl-2-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridine-7-carboxylate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 5-phenyl-2-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 46608984 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 5-phenyl-2-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridine-7-carboxylate |
| SMILES | COCCNC(=O)COC(=O)c1cc(-c2ccccc2)nc2nc(N3CCCCC3)sc12 |
| InChI | InChI=1S/C23H26N4O4S/c1-30-13-10-24-19(28)15-31-22(29)17-14-18(16-8-4-2-5-9-16)25-21-20(17)32-23(26-21)27-11-6-3-7-12-27/h2,4-5,8-9,14H,3,6-7,10-13,15H2,1H3,(H,24,28) |
| InChIKey | BYZDVAMUJYXPIV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|