C24H21FN4O4 — CID 46612528
1-(4-fluorophenyl)-3,5-dimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyrazole-4-carbohydrazide (PubChem CID 46612528) has the molecular formula C24H21FN4O4 and a molecular weight of 448.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,5-dimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyrazole-4-carbohydrazide.
| Compound Name | 1-(4-fluorophenyl)-3,5-dimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46612528 |
| Molecular Formula | C24H21FN4O4 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-(4-fluorophenyl)-3,5-dimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]pyrazole-4-carbohydrazide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C(=O)NNC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C24H21FN4O4/c1-15-22(16(2)29(28-15)18-10-8-17(25)9-11-18)24(31)27-26-23(30)21-13-12-20(33-21)14-32-19-6-4-3-5-7-19/h3-13H,14H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | GAYYKIUCKQHDND-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|