C22H19N3O4 — CID 26808263
2-methyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]-1H-indole-3-carbohydrazide (PubChem CID 26808263) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-methyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]-1H-indole-3-carbohydrazide.
| Compound Name | 2-methyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 26808263 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-methyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]-1H-indole-3-carbohydrazide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)NNC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C22H19N3O4/c1-14-20(17-9-5-6-10-18(17)23-14)22(27)25-24-21(26)19-12-11-16(29-19)13-28-15-7-3-2-4-8-15/h2-12,23H,13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | GROBNRPXFFJBBI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|