C21H21N3O5 — CID 31466059
4-acetyl-3,5-dimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 31466059) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-acetyl-3,5-dimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-acetyl-3,5-dimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31466059 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-acetyl-3,5-dimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)NNC(=O)c2ccc(COc3ccccc3)o2)c1C |
| InChI | InChI=1S/C21H21N3O5/c1-12-18(14(3)25)13(2)22-19(12)21(27)24-23-20(26)17-10-9-16(29-17)11-28-15-7-5-4-6-8-15/h4-10,22H,11H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | LMQITXDXHWKCTH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|