C20H22BrN5O4 — CID 46614305
N-(2-bromophenyl)-2-[[2-[4-(4-nitrophenyl)piperazin-1-yl]acetyl]amino]acetamide (PubChem CID 46614305) has the molecular formula C20H22BrN5O4 and a molecular weight of 476.33 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[[2-[4-(4-nitrophenyl)piperazin-1-yl]acetyl]amino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[[2-[4-(4-nitrophenyl)piperazin-1-yl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 46614305 |
| Molecular Formula | C20H22BrN5O4 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-(2-bromophenyl)-2-[[2-[4-(4-nitrophenyl)piperazin-1-yl]acetyl]amino]acetamide |
| SMILES | O=C(CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C20H22BrN5O4/c21-17-3-1-2-4-18(17)23-19(27)13-22-20(28)14-24-9-11-25(12-10-24)15-5-7-16(8-6-15)26(29)30/h1-8H,9-14H2,(H,22,28)(H,23,27) |
| InChIKey | RZHOIBHLCWLEAI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|