C22H28N2O5 — CID 46619373
[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 4-oxo-4-(4-pentylphenyl)butanoate (PubChem CID 46619373) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 4-oxo-4-(4-pentylphenyl)butanoate.
| Compound Name | [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 4-oxo-4-(4-pentylphenyl)butanoate |
|---|---|
| PubChem CID | 46619373 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 4-oxo-4-(4-pentylphenyl)butanoate |
| SMILES | CCCCCc1ccc(C(=O)CCC(=O)OC(C)C(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C22H28N2O5/c1-4-5-6-7-17-8-10-18(11-9-17)19(25)12-13-21(26)28-16(3)22(27)23-20-14-15(2)29-24-20/h8-11,14,16H,4-7,12-13H2,1-3H3,(H,23,24,27) |
| InChIKey | PPXQCMNKFNSUMU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|