C21H23F2NO3 — CID 46622818
[1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 3-methyl-2-phenylpentanoate (PubChem CID 46622818) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 3-methyl-2-phenylpentanoate.
| Compound Name | [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 3-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 46622818 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 3-methyl-2-phenylpentanoate |
| SMILES | CCC(C)C(C(=O)OC(C)C(=O)Nc1c(F)cccc1F)c1ccccc1 |
| InChI | InChI=1S/C21H23F2NO3/c1-4-13(2)18(15-9-6-5-7-10-15)21(26)27-14(3)20(25)24-19-16(22)11-8-12-17(19)23/h5-14,18H,4H2,1-3H3,(H,24,25) |
| InChIKey | DSEPRKOODAIHDR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |