C21H26N2O5S — CID 8970855
[(2S)-1-oxo-1-(3-sulfamoylanilino)propan-2-yl] (2S,3R)-3-methyl-2-phenylpentanoate (PubChem CID 8970855) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(3-sulfamoylanilino)propan-2-yl] (2S,3R)-3-methyl-2-phenylpentanoate.
| Compound Name | [(2S)-1-oxo-1-(3-sulfamoylanilino)propan-2-yl] (2S,3R)-3-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 8970855 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [(2S)-1-oxo-1-(3-sulfamoylanilino)propan-2-yl] (2S,3R)-3-methyl-2-phenylpentanoate |
| SMILES | CC[C@@H](C)[C@H](C(=O)O[C@@H](C)C(=O)Nc1cccc(S(N)(=O)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-4-14(2)19(16-9-6-5-7-10-16)21(25)28-15(3)20(24)23-17-11-8-12-18(13-17)29(22,26)27/h5-15,19H,4H2,1-3H3,(H,23,24)(H2,22,26,27)/t14-,15+,19+/m1/s1 |
| InChIKey | DKPVSPIJXRXUBZ-VCBZYWHSSA-N |
| XLogP | 3.03 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |