C25H31N3O3S — CID 46628179
1-(2-cyanophenyl)sulfonyl-N-[1-[4-(2-methylpropyl)phenyl]ethyl]piperidine-4-carboxamide (PubChem CID 46628179) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is 1-(2-cyanophenyl)sulfonyl-N-[1-[4-(2-methylpropyl)phenyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-cyanophenyl)sulfonyl-N-[1-[4-(2-methylpropyl)phenyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46628179 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 1-(2-cyanophenyl)sulfonyl-N-[1-[4-(2-methylpropyl)phenyl]ethyl]piperidine-4-carboxamide |
| SMILES | CC(C)Cc1ccc(C(C)NC(=O)C2CCN(S(=O)(=O)c3ccccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O3S/c1-18(2)16-20-8-10-21(11-9-20)19(3)27-25(29)22-12-14-28(15-13-22)32(30,31)24-7-5-4-6-23(24)17-26/h4-11,18-19,22H,12-16H2,1-3H3,(H,27,29) |
| InChIKey | KOYQJXFMWBCTJE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |